About benzamido ethanesulfonate
benzamido ethanesulfonate (PubChem CID 134265286) has the molecular formula C9H11NO4S
and a molecular weight of 229.26 g/mol. Its IUPAC name is benzamido ethanesulfonate.
Molecular Properties
| Compound Name | benzamido ethanesulfonate |
| PubChem CID | 134265286 |
| Molecular Formula | C9H11NO4S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | benzamido ethanesulfonate |
| SMILES | CCS(=O)(=O)ONC(=O)c1ccccc1 |
| InChI | InChI=1S/C9H11NO4S/c1-2-15(12,13)14-10-9(11)8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11) |
| InChIKey | GFUPURWINYQPLW-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzamido ethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzamido ethanesulfonate?
The IUPAC name of benzamido ethanesulfonate (CID 134265286) is benzamido ethanesulfonate.
What is the SMILES notation for benzamido ethanesulfonate?
The canonical SMILES for benzamido ethanesulfonate is CCS(=O)(=O)ONC(=O)c1ccccc1.
What is the InChIKey of benzamido ethanesulfonate?
The InChIKey is GFUPURWINYQPLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO4S/c1-2-15(12,13)14-10-9(11)8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11).
What are the key properties of benzamido ethanesulfonate?
benzamido ethanesulfonate has a molecular weight of 229.26 g/mol, XLogP of 0.70, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzamido ethanesulfonate is sourced from PubChem (CID 134265286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).