C10H16O10S2 — CID 87428104
3-[(Z)-4-oxo-4-(3-sulfopropoxy)but-2-enoyl]oxypropane-1-sulfonic acid (PubChem CID 87428104) has the molecular formula C10H16O10S2 and a molecular weight of 360.36 g/mol. Its IUPAC name is 3-[(Z)-4-oxo-4-(3-sulfopropoxy)but-2-enoyl]oxypropane-1-sulfonic acid.
| Compound Name | 3-[(Z)-4-oxo-4-(3-sulfopropoxy)but-2-enoyl]oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 87428104 |
| Molecular Formula | C10H16O10S2 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | 3-[(Z)-4-oxo-4-(3-sulfopropoxy)but-2-enoyl]oxypropane-1-sulfonic acid |
| SMILES | O=C(/C=C\C(=O)OCCCS(=O)(=O)O)OCCCS(=O)(=O)O |
| InChI | InChI=1S/C10H16O10S2/c11-9(19-5-1-7-21(13,14)15)3-4-10(12)20-6-2-8-22(16,17)18/h3-4H,1-2,5-8H2,(H,13,14,15)(H,16,17,18)/b4-3- |
| InChIKey | IKJXIDVHIZQZAW-ARJAWSKDSA-N |
| XLogP | -0.82 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|