C13H24ClNO5S — CID 176909660
3-but-2-enoyloxypropyl-ethenyl-methyl-(3-sulfopropyl)azanium chloride (PubChem CID 176909660) has the molecular formula C13H24ClNO5S and a molecular weight of 341.86 g/mol. Its IUPAC name is 3-but-2-enoyloxypropyl-ethenyl-methyl-(3-sulfopropyl)azanium chloride.
| Compound Name | 3-but-2-enoyloxypropyl-ethenyl-methyl-(3-sulfopropyl)azanium chloride |
|---|---|
| PubChem CID | 176909660 |
| Molecular Formula | C13H24ClNO5S |
| Molecular Weight | 341.86 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 3-but-2-enoyloxypropyl-ethenyl-methyl-(3-sulfopropyl)azanium chloride |
| SMILES | C=C[N+](C)(CCCOC(=O)C=CC)CCCS(=O)(=O)O.[Cl-] |
| InChI | InChI=1S/C13H23NO5S.ClH/c1-4-8-13(15)19-11-6-9-14(3,5-2)10-7-12-20(16,17)18;/h4-5,8H,2,6-7,9-12H2,1,3H3;1H |
| InChIKey | CFJQLVLURIOEFR-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.86 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|