C17H39NO6S — CID 158271977
propan-2-amine;propan-2-yl 2,2-dimethylpropanoate;3-propan-2-yloxypropane-1-sulfonic acid (PubChem CID 158271977) has the molecular formula C17H39NO6S and a molecular weight of 385.57 g/mol. Its IUPAC name is propan-2-amine;propan-2-yl 2,2-dimethylpropanoate;3-propan-2-yloxypropane-1-sulfonic acid.
| Compound Name | propan-2-amine;propan-2-yl 2,2-dimethylpropanoate;3-propan-2-yloxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 158271977 |
| Molecular Formula | C17H39NO6S |
| Molecular Weight | 385.57 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | propan-2-amine;propan-2-yl 2,2-dimethylpropanoate;3-propan-2-yloxypropane-1-sulfonic acid |
| SMILES | CC(C)N.CC(C)OC(=O)C(C)(C)C.CC(C)OCCCS(=O)(=O)O |
| InChI | InChI=1S/C8H16O2.C6H14O4S.C3H9N/c1-6(2)10-7(9)8(3,4)5;1-6(2)10-4-3-5-11(7,8)9;1-3(2)4/h6H,1-5H3;6H,3-5H2,1-2H3,(H,7,8,9);3H,4H2,1-2H3 |
| InChIKey | GJDLNZPGBRKSDQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.57 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|