C10H21NO6S — CID 175590348
3-[1-amino-3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]propane-1-sulfonic acid (PubChem CID 175590348) has the molecular formula C10H21NO6S and a molecular weight of 283.35 g/mol. Its IUPAC name is 3-[1-amino-3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]propane-1-sulfonic acid.
| Compound Name | 3-[1-amino-3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 175590348 |
| Molecular Formula | C10H21NO6S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 3-[1-amino-3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]propane-1-sulfonic acid |
| SMILES | CC(C)(C)OC(=O)CC(N)OCCCS(=O)(=O)O |
| InChI | InChI=1S/C10H21NO6S/c1-10(2,3)17-9(12)7-8(11)16-5-4-6-18(13,14)15/h8H,4-7,11H2,1-3H3,(H,13,14,15) |
| InChIKey | VUINUYPGYRMZDO-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|