About [1-amino-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl] 6-nitrooxyhexanoate
[1-amino-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl] 6-nitrooxyhexanoate (PubChem CID 87615007) has the molecular formula C13H24N2O7
and a molecular weight of 320.34 g/mol. Its IUPAC name is [1-amino-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl] 6-nitrooxyhexanoate.
Molecular Properties
| Compound Name | [1-amino-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl] 6-nitrooxyhexanoate |
| PubChem CID | 87615007 |
| Molecular Formula | C13H24N2O7 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | [1-amino-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl] 6-nitrooxyhexanoate |
| SMILES | CC(C)(C)OC(=O)CC(N)OC(=O)CCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C13H24N2O7/c1-13(2,3)22-12(17)9-10(14)21-11(16)7-5-4-6-8-20-15(18)19/h10H,4-9,14H2,1-3H3 |
| InChIKey | XFAYURWFDWXNGG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 130.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-amino-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl] 6-nitrooxyhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-amino-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl] 6-nitrooxyhexanoate?
The IUPAC name of [1-amino-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl] 6-nitrooxyhexanoate (CID 87615007) is [1-amino-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl] 6-nitrooxyhexanoate.
What is the SMILES notation for [1-amino-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl] 6-nitrooxyhexanoate?
The canonical SMILES for [1-amino-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl] 6-nitrooxyhexanoate is CC(C)(C)OC(=O)CC(N)OC(=O)CCCCCO[N+](=O)[O-].
What is the InChIKey of [1-amino-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl] 6-nitrooxyhexanoate?
The InChIKey is XFAYURWFDWXNGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O7/c1-13(2,3)22-12(17)9-10(14)21-11(16)7-5-4-6-8-20-15(18)19/h10H,4-9,14H2,1-3H3.
What are the key properties of [1-amino-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl] 6-nitrooxyhexanoate?
[1-amino-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl] 6-nitrooxyhexanoate has a molecular weight of 320.34 g/mol, XLogP of 1.31, 10 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [1-amino-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl] 6-nitrooxyhexanoate is sourced from PubChem (CID 87615007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).