C15H30O3 — CID 166750043
(2-methyl-6-propan-2-yloxyhexan-2-yl) 2,2-dimethylpropanoate (PubChem CID 166750043) has the molecular formula C15H30O3 and a molecular weight of 258.40 g/mol. Its IUPAC name is (2-methyl-6-propan-2-yloxyhexan-2-yl) 2,2-dimethylpropanoate.
| Compound Name | (2-methyl-6-propan-2-yloxyhexan-2-yl) 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 166750043 |
| Molecular Formula | C15H30O3 |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.22 |
| IUPAC Name | (2-methyl-6-propan-2-yloxyhexan-2-yl) 2,2-dimethylpropanoate |
| SMILES | CC(C)OCCCCC(C)(C)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C15H30O3/c1-12(2)17-11-9-8-10-15(6,7)18-13(16)14(3,4)5/h12H,8-11H2,1-7H3 |
| InChIKey | LHQYELXDWFWQCR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|