C37H74O6 — CID 161231899
butyl (2R)-2-tert-butyl-4-methylpentanoate;butyl (2R)-2,3,3-trimethylbutanoate;ethyl (2R)-2-tert-butyl-4-methylpentanoate (PubChem CID 161231899) has the molecular formula C37H74O6 and a molecular weight of 614.99 g/mol. Its IUPAC name is butyl (2R)-2-tert-butyl-4-methylpentanoate;butyl (2R)-2,3,3-trimethylbutanoate;ethyl (2R)-2-tert-butyl-4-methylpentanoate.
| Compound Name | butyl (2R)-2-tert-butyl-4-methylpentanoate;butyl (2R)-2,3,3-trimethylbutanoate;ethyl (2R)-2-tert-butyl-4-methylpentanoate |
|---|---|
| PubChem CID | 161231899 |
| Molecular Formula | C37H74O6 |
| Molecular Weight | 614.99 g/mol |
| Exact Mass | 614.55 |
| IUPAC Name | butyl (2R)-2-tert-butyl-4-methylpentanoate;butyl (2R)-2,3,3-trimethylbutanoate;ethyl (2R)-2-tert-butyl-4-methylpentanoate |
| SMILES | CCCCOC(=O)[C@H](C)C(C)(C)C.CCCCOC(=O)[C@H](CC(C)C)C(C)(C)C.CCOC(=O)[C@H](CC(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H28O2.C12H24O2.C11H22O2/c1-7-8-9-16-13(15)12(10-11(2)3)14(4,5)6;1-7-14-11(13)10(8-9(2)3)12(4,5)6;1-6-7-8-13-10(12)9(2)11(3,4)5/h11-12H,7-10H2,1-6H3;9-10H,7-8H2,1-6H3;9H,6-8H2,1-5H3/t12-;10-;9-/m000/s1 |
| InChIKey | UYWAOINFWHCYFZ-BZYMOYFASA-N |
| XLogP | 10.31 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.99 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|