C23H35BrO5S — CID 58462698
1-O-[[(5Z)-5-(bromomethylidene)-2-oxothiophen-3-yl]methyl] 5-O-butyl 4-tert-butyl-2-(2-methylpropyl)pentanedioate (PubChem CID 58462698) has the molecular formula C23H35BrO5S and a molecular weight of 503.50 g/mol. Its IUPAC name is 1-O-[[(5Z)-5-(bromomethylidene)-2-oxothiophen-3-yl]methyl] 5-O-butyl 4-tert-butyl-2-(2-methylpropyl)pentanedioate.
| Compound Name | 1-O-[[(5Z)-5-(bromomethylidene)-2-oxothiophen-3-yl]methyl] 5-O-butyl 4-tert-butyl-2-(2-methylpropyl)pentanedioate |
|---|---|
| PubChem CID | 58462698 |
| Molecular Formula | C23H35BrO5S |
| Molecular Weight | 503.50 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | 1-O-[[(5Z)-5-(bromomethylidene)-2-oxothiophen-3-yl]methyl] 5-O-butyl 4-tert-butyl-2-(2-methylpropyl)pentanedioate |
| SMILES | CCCCOC(=O)C(CC(CC(C)C)C(=O)OCC1=C/C(=C/Br)SC1=O)C(C)(C)C |
| InChI | InChI=1S/C23H35BrO5S/c1-7-8-9-28-21(26)19(23(4,5)6)12-16(10-15(2)3)20(25)29-14-17-11-18(13-24)30-22(17)27/h11,13,15-16,19H,7-10,12,14H2,1-6H3/b18-13- |
| InChIKey | AKSGOFCEPWSJEO-AQTBWJFISA-N |
| XLogP | 6.02 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.50 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|