C10H19N3O7 — CID 160578189
(2S)-4-amino-2-(methylamino)-4-oxobutanoic acid;(2R)-2-aminopentanedioic acid (PubChem CID 160578189) has the molecular formula C10H19N3O7 and a molecular weight of 293.28 g/mol. Its IUPAC name is (2S)-4-amino-2-(methylamino)-4-oxobutanoic acid;(2R)-2-aminopentanedioic acid.
| Compound Name | (2S)-4-amino-2-(methylamino)-4-oxobutanoic acid;(2R)-2-aminopentanedioic acid |
|---|---|
| PubChem CID | 160578189 |
| Molecular Formula | C10H19N3O7 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | (2S)-4-amino-2-(methylamino)-4-oxobutanoic acid;(2R)-2-aminopentanedioic acid |
| SMILES | CN[C@@H](CC(N)=O)C(=O)O.N[C@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C5H10N2O3.C5H9NO4/c1-7-3(5(9)10)2-4(6)8;6-3(5(9)10)1-2-4(7)8/h3,7H,2H2,1H3,(H2,6,8)(H,9,10);3H,1-2,6H2,(H,7,8)(H,9,10)/t2*3-/m01/s1 |
| InChIKey | RBKSAONPRCXAMR-OCZOEHNFSA-N |
| XLogP | -2.20 |
| TPSA | 193.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |