C18H24N6O6S2 — CID 132943204
N-[3-[[4-amino-4-oxo-2-[(2-sulfanylacetyl)amino]butanoyl]amino]phenyl]-2-[(2-sulfanylacetyl)amino]butanediamide (PubChem CID 132943204) has the molecular formula C18H24N6O6S2 and a molecular weight of 484.56 g/mol. Its IUPAC name is N-[3-[[4-amino-4-oxo-2-[(2-sulfanylacetyl)amino]butanoyl]amino]phenyl]-2-[(2-sulfanylacetyl)amino]butanediamide.
| Compound Name | N-[3-[[4-amino-4-oxo-2-[(2-sulfanylacetyl)amino]butanoyl]amino]phenyl]-2-[(2-sulfanylacetyl)amino]butanediamide |
|---|---|
| PubChem CID | 132943204 |
| Molecular Formula | C18H24N6O6S2 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | N-[3-[[4-amino-4-oxo-2-[(2-sulfanylacetyl)amino]butanoyl]amino]phenyl]-2-[(2-sulfanylacetyl)amino]butanediamide |
| SMILES | NC(=O)CC(NC(=O)CS)C(=O)Nc1cccc(NC(=O)C(CC(N)=O)NC(=O)CS)c1 |
| InChI | InChI=1S/C18H24N6O6S2/c19-13(25)5-11(23-15(27)7-31)17(29)21-9-2-1-3-10(4-9)22-18(30)12(6-14(20)26)24-16(28)8-32/h1-4,11-12,31-32H,5-8H2,(H2,19,25)(H2,20,26)(H,21,29)(H,22,30)(H,23,27)(H,24,28) |
| InChIKey | IUXZDBWALCPOBH-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 202.58 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|