C8H15N2O6P — CID 87478022
5-amino-5-oxo-2-(1-phosphonoprop-2-enylamino)pentanoic acid (PubChem CID 87478022) has the molecular formula C8H15N2O6P and a molecular weight of 266.19 g/mol. Its IUPAC name is 5-amino-5-oxo-2-(1-phosphonoprop-2-enylamino)pentanoic acid.
| Compound Name | 5-amino-5-oxo-2-(1-phosphonoprop-2-enylamino)pentanoic acid |
|---|---|
| PubChem CID | 87478022 |
| Molecular Formula | C8H15N2O6P |
| Molecular Weight | 266.19 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 5-amino-5-oxo-2-(1-phosphonoprop-2-enylamino)pentanoic acid |
| SMILES | C=CC(NC(CCC(N)=O)C(=O)O)P(=O)(O)O |
| InChI | InChI=1S/C8H15N2O6P/c1-2-7(17(14,15)16)10-5(8(12)13)3-4-6(9)11/h2,5,7,10H,1,3-4H2,(H2,9,11)(H,12,13)(H2,14,15,16) |
| InChIKey | NXQJQYWOGTUBIE-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 149.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.19 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|