C12H24N2O8P2 — CID 87493317
(2S)-2,6-bis(1-phosphonoprop-2-enylamino)hexanoic acid (PubChem CID 87493317) has the molecular formula C12H24N2O8P2 and a molecular weight of 386.28 g/mol. Its IUPAC name is (2S)-2,6-bis(1-phosphonoprop-2-enylamino)hexanoic acid.
| Compound Name | (2S)-2,6-bis(1-phosphonoprop-2-enylamino)hexanoic acid |
|---|---|
| PubChem CID | 87493317 |
| Molecular Formula | C12H24N2O8P2 |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | (2S)-2,6-bis(1-phosphonoprop-2-enylamino)hexanoic acid |
| SMILES | C=CC(NCCCC[C@H](NC(C=C)P(=O)(O)O)C(=O)O)P(=O)(O)O |
| InChI | InChI=1S/C12H24N2O8P2/c1-3-10(23(17,18)19)13-8-6-5-7-9(12(15)16)14-11(4-2)24(20,21)22/h3-4,9-11,13-14H,1-2,5-8H2,(H,15,16)(H2,17,18,19)(H2,20,21,22)/t9-,10?,11?/m0/s1 |
| InChIKey | BCDFVGMZAOKXQK-WHXUTIOJSA-N |
| XLogP | 0.17 |
| TPSA | 176.42 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|