C6H12NO5P — CID 87479265
(2S)-2-(1-phosphonoprop-2-enylamino)propanoic acid (PubChem CID 87479265) has the molecular formula C6H12NO5P and a molecular weight of 209.14 g/mol. Its IUPAC name is (2S)-2-(1-phosphonoprop-2-enylamino)propanoic acid.
| Compound Name | (2S)-2-(1-phosphonoprop-2-enylamino)propanoic acid |
|---|---|
| PubChem CID | 87479265 |
| Molecular Formula | C6H12NO5P |
| Molecular Weight | 209.14 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | (2S)-2-(1-phosphonoprop-2-enylamino)propanoic acid |
| SMILES | C=CC(N[C@@H](C)C(=O)O)P(=O)(O)O |
| InChI | InChI=1S/C6H12NO5P/c1-3-5(13(10,11)12)7-4(2)6(8)9/h3-5,7H,1H2,2H3,(H,8,9)(H2,10,11,12)/t4-,5?/m0/s1 |
| InChIKey | FSZBFPCTIHZWOR-ROLXFIACSA-N |
| XLogP | -0.26 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.14 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|