C7H12NO4P — CID 87684851
1-(2-methylprop-2-enoylamino)prop-2-enylphosphonic acid (PubChem CID 87684851) has the molecular formula C7H12NO4P and a molecular weight of 205.15 g/mol. Its IUPAC name is 1-(2-methylprop-2-enoylamino)prop-2-enylphosphonic acid.
| Compound Name | 1-(2-methylprop-2-enoylamino)prop-2-enylphosphonic acid |
|---|---|
| PubChem CID | 87684851 |
| Molecular Formula | C7H12NO4P |
| Molecular Weight | 205.15 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | 1-(2-methylprop-2-enoylamino)prop-2-enylphosphonic acid |
| SMILES | C=CC(NC(=O)C(=C)C)P(=O)(O)O |
| InChI | InChI=1S/C7H12NO4P/c1-4-6(13(10,11)12)8-7(9)5(2)3/h4,6H,1-2H2,3H3,(H,8,9)(H2,10,11,12) |
| InChIKey | CPSRHXJZNGRTPB-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.15 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|