C8H18N3O5P — CID 23728533
7-amino-7-imino-2-(phosphonomethylamino)heptanoic acid (PubChem CID 23728533) has the molecular formula C8H18N3O5P and a molecular weight of 267.22 g/mol. Its IUPAC name is 7-amino-7-imino-2-(phosphonomethylamino)heptanoic acid.
| Compound Name | 7-amino-7-imino-2-(phosphonomethylamino)heptanoic acid |
|---|---|
| PubChem CID | 23728533 |
| Molecular Formula | C8H18N3O5P |
| Molecular Weight | 267.22 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 7-amino-7-imino-2-(phosphonomethylamino)heptanoic acid |
| SMILES | [H]/N=C(\N)CCCCC(NCP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C8H18N3O5P/c9-7(10)4-2-1-3-6(8(12)13)11-5-17(14,15)16/h6,11H,1-5H2,(H3,9,10)(H,12,13)(H2,14,15,16) |
| InChIKey | PFOUVAREWDEYMD-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 156.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.22 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|