C25H27FNO8PS — CID 11455643
[acetyloxymethoxy-[(3R)-3-(1-benzothiophene-2-carbonylamino)-4-(3-fluorophenyl)butyl]phosphoryl]oxymethyl acetate (PubChem CID 11455643) has the molecular formula C25H27FNO8PS and a molecular weight of 551.53 g/mol. Its IUPAC name is [acetyloxymethoxy-[(3R)-3-(1-benzothiophene-2-carbonylamino)-4-(3-fluorophenyl)butyl]phosphoryl]oxymethyl acetate.
| Compound Name | [acetyloxymethoxy-[(3R)-3-(1-benzothiophene-2-carbonylamino)-4-(3-fluorophenyl)butyl]phosphoryl]oxymethyl acetate |
|---|---|
| PubChem CID | 11455643 |
| Molecular Formula | C25H27FNO8PS |
| Molecular Weight | 551.53 g/mol |
| Exact Mass | 551.12 |
| IUPAC Name | [acetyloxymethoxy-[(3R)-3-(1-benzothiophene-2-carbonylamino)-4-(3-fluorophenyl)butyl]phosphoryl]oxymethyl acetate |
| SMILES | CC(=O)OCOP(=O)(CC[C@@H](Cc1cccc(F)c1)NC(=O)c1cc2ccccc2s1)OCOC(C)=O |
| InChI | InChI=1S/C25H27FNO8PS/c1-17(28)32-15-34-36(31,35-16-33-18(2)29)11-10-22(13-19-6-5-8-21(26)12-19)27-25(30)24-14-20-7-3-4-9-23(20)37-24/h3-9,12,14,22H,10-11,13,15-16H2,1-2H3,(H,27,30)/t22-/m0/s1 |
| InChIKey | NONFBSJBZFMPRJ-QFIPXVFZSA-N |
| XLogP | 5.04 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.53 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|