C18H17FNO5PS — CID 11418384
[(2R)-2-(1-benzothiophene-2-carbonylamino)-3-(3-fluorophenyl)propyl] dihydrogen phosphate (PubChem CID 11418384) has the molecular formula C18H17FNO5PS and a molecular weight of 409.38 g/mol. Its IUPAC name is [(2R)-2-(1-benzothiophene-2-carbonylamino)-3-(3-fluorophenyl)propyl] dihydrogen phosphate.
| Compound Name | [(2R)-2-(1-benzothiophene-2-carbonylamino)-3-(3-fluorophenyl)propyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 11418384 |
| Molecular Formula | C18H17FNO5PS |
| Molecular Weight | 409.38 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | [(2R)-2-(1-benzothiophene-2-carbonylamino)-3-(3-fluorophenyl)propyl] dihydrogen phosphate |
| SMILES | O=C(N[C@@H](COP(=O)(O)O)Cc1cccc(F)c1)c1cc2ccccc2s1 |
| InChI | InChI=1S/C18H17FNO5PS/c19-14-6-3-4-12(8-14)9-15(11-25-26(22,23)24)20-18(21)17-10-13-5-1-2-7-16(13)27-17/h1-8,10,15H,9,11H2,(H,20,21)(H2,22,23,24)/t15-/m1/s1 |
| InChIKey | DLTOZAQIUILLDJ-OAHLLOKOSA-N |
| XLogP | 3.49 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|