C16H15Cl2NO2 — CID 107861388
2,3-dichloro-N-[(2R)-1-hydroxy-3-phenylpropan-2-yl]benzamide (PubChem CID 107861388) has the molecular formula C16H15Cl2NO2 and a molecular weight of 324.21 g/mol. Its IUPAC name is 2,3-dichloro-N-[(2R)-1-hydroxy-3-phenylpropan-2-yl]benzamide.
| Compound Name | 2,3-dichloro-N-[(2R)-1-hydroxy-3-phenylpropan-2-yl]benzamide |
|---|---|
| PubChem CID | 107861388 |
| Molecular Formula | C16H15Cl2NO2 |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 2,3-dichloro-N-[(2R)-1-hydroxy-3-phenylpropan-2-yl]benzamide |
| SMILES | O=C(N[C@@H](CO)Cc1ccccc1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H15Cl2NO2/c17-14-8-4-7-13(15(14)18)16(21)19-12(10-20)9-11-5-2-1-3-6-11/h1-8,12,20H,9-10H2,(H,19,21)/t12-/m1/s1 |
| InChIKey | NNZOSYKMGMFVDS-GFCCVEGCSA-N |
| XLogP | 3.33 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |