C10H12INO3 — CID 65312404
N-(1,3-dihydroxypropan-2-yl)-2-iodobenzamide (PubChem CID 65312404) has the molecular formula C10H12INO3 and a molecular weight of 321.11 g/mol. Its IUPAC name is N-(1,3-dihydroxypropan-2-yl)-2-iodobenzamide.
| Compound Name | N-(1,3-dihydroxypropan-2-yl)-2-iodobenzamide |
|---|---|
| PubChem CID | 65312404 |
| Molecular Formula | C10H12INO3 |
| Molecular Weight | 321.11 g/mol |
| Exact Mass | 320.99 |
| IUPAC Name | N-(1,3-dihydroxypropan-2-yl)-2-iodobenzamide |
| SMILES | O=C(NC(CO)CO)c1ccccc1I |
| InChI | InChI=1S/C10H12INO3/c11-9-4-2-1-3-8(9)10(15)12-7(5-13)6-14/h1-4,7,13-14H,5-6H2,(H,12,15) |
| InChIKey | KTLFYNDTNQTTJU-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.11 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|