C12H18N2O3 — CID 65314197
2-(2-aminoethyl)-N-(1,3-dihydroxypropan-2-yl)benzamide (PubChem CID 65314197) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-(2-aminoethyl)-N-(1,3-dihydroxypropan-2-yl)benzamide.
| Compound Name | 2-(2-aminoethyl)-N-(1,3-dihydroxypropan-2-yl)benzamide |
|---|---|
| PubChem CID | 65314197 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 2-(2-aminoethyl)-N-(1,3-dihydroxypropan-2-yl)benzamide |
| SMILES | NCCc1ccccc1C(=O)NC(CO)CO |
| InChI | InChI=1S/C12H18N2O3/c13-6-5-9-3-1-2-4-11(9)12(17)14-10(7-15)8-16/h1-4,10,15-16H,5-8,13H2,(H,14,17) |
| InChIKey | OWXFODBLXDNJOO-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |