C11H13F2NO4 — CID 65309961
2-(difluoromethoxy)-N-(1,3-dihydroxypropan-2-yl)benzamide (PubChem CID 65309961) has the molecular formula C11H13F2NO4 and a molecular weight of 261.22 g/mol. Its IUPAC name is 2-(difluoromethoxy)-N-(1,3-dihydroxypropan-2-yl)benzamide.
| Compound Name | 2-(difluoromethoxy)-N-(1,3-dihydroxypropan-2-yl)benzamide |
|---|---|
| PubChem CID | 65309961 |
| Molecular Formula | C11H13F2NO4 |
| Molecular Weight | 261.22 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 2-(difluoromethoxy)-N-(1,3-dihydroxypropan-2-yl)benzamide |
| SMILES | O=C(NC(CO)CO)c1ccccc1OC(F)F |
| InChI | InChI=1S/C11H13F2NO4/c12-11(13)18-9-4-2-1-3-8(9)10(17)14-7(5-15)6-16/h1-4,7,11,15-16H,5-6H2,(H,14,17) |
| InChIKey | GSYBAJRTBFFNRJ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.22 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |