C21H17O2PRh — CID 175984938
1-(2-diphenylphosphanylphenyl)propane-1,2-dione;rhodium (PubChem CID 175984938) has the molecular formula C21H17O2PRh and a molecular weight of 435.25 g/mol. Its IUPAC name is 1-(2-diphenylphosphanylphenyl)propane-1,2-dione;rhodium.
| Compound Name | 1-(2-diphenylphosphanylphenyl)propane-1,2-dione;rhodium |
|---|---|
| PubChem CID | 175984938 |
| Molecular Formula | C21H17O2PRh |
| Molecular Weight | 435.25 g/mol |
| Exact Mass | 435.00 |
| IUPAC Name | 1-(2-diphenylphosphanylphenyl)propane-1,2-dione;rhodium |
| SMILES | CC(=O)C(=O)c1ccccc1P(c1ccccc1)c1ccccc1.[Rh] |
| InChI | InChI=1S/C21H17O2P.Rh/c1-16(22)21(23)19-14-8-9-15-20(19)24(17-10-4-2-5-11-17)18-12-6-3-7-13-18;/h2-15H,1H3; |
| InChIKey | WTNMJMOZNIMMKO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.25 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|