C14H18F3NOS — CID 78860224
N,N-dipropyl-2-(trifluoromethylsulfanyl)benzamide (PubChem CID 78860224) has the molecular formula C14H18F3NOS and a molecular weight of 305.36 g/mol. Its IUPAC name is N,N-dipropyl-2-(trifluoromethylsulfanyl)benzamide.
| Compound Name | N,N-dipropyl-2-(trifluoromethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 78860224 |
| Molecular Formula | C14H18F3NOS |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | N,N-dipropyl-2-(trifluoromethylsulfanyl)benzamide |
| SMILES | CCCN(CCC)C(=O)c1ccccc1SC(F)(F)F |
| InChI | InChI=1S/C14H18F3NOS/c1-3-9-18(10-4-2)13(19)11-7-5-6-8-12(11)20-14(15,16)17/h5-8H,3-4,9-10H2,1-2H3 |
| InChIKey | IARQDDNVSKDYDM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |