C11H11F3N2O3S — CID 106165344
N-(3-amino-2-hydroxy-3-oxopropyl)-2-(trifluoromethylsulfanyl)benzamide (PubChem CID 106165344) has the molecular formula C11H11F3N2O3S and a molecular weight of 308.28 g/mol. Its IUPAC name is N-(3-amino-2-hydroxy-3-oxopropyl)-2-(trifluoromethylsulfanyl)benzamide.
| Compound Name | N-(3-amino-2-hydroxy-3-oxopropyl)-2-(trifluoromethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 106165344 |
| Molecular Formula | C11H11F3N2O3S |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | N-(3-amino-2-hydroxy-3-oxopropyl)-2-(trifluoromethylsulfanyl)benzamide |
| SMILES | NC(=O)C(O)CNC(=O)c1ccccc1SC(F)(F)F |
| InChI | InChI=1S/C11H11F3N2O3S/c12-11(13,14)20-8-4-2-1-3-6(8)10(19)16-5-7(17)9(15)18/h1-4,7,17H,5H2,(H2,15,18)(H,16,19) |
| InChIKey | UQEHGUGWCOGLDN-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |