C11H12F3NO2S — CID 43427741
N-(2-hydroxypropyl)-2-(trifluoromethylsulfanyl)benzamide (PubChem CID 43427741) has the molecular formula C11H12F3NO2S and a molecular weight of 279.28 g/mol. Its IUPAC name is N-(2-hydroxypropyl)-2-(trifluoromethylsulfanyl)benzamide.
| Compound Name | N-(2-hydroxypropyl)-2-(trifluoromethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 43427741 |
| Molecular Formula | C11H12F3NO2S |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | N-(2-hydroxypropyl)-2-(trifluoromethylsulfanyl)benzamide |
| SMILES | CC(O)CNC(=O)c1ccccc1SC(F)(F)F |
| InChI | InChI=1S/C11H12F3NO2S/c1-7(16)6-15-10(17)8-4-2-3-5-9(8)18-11(12,13)14/h2-5,7,16H,6H2,1H3,(H,15,17) |
| InChIKey | ONAVGZYUJDBURX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |