C19H20F3N3O2S — CID 60556371
N-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]-2-(trifluoromethylsulfanyl)benzamide (PubChem CID 60556371) has the molecular formula C19H20F3N3O2S and a molecular weight of 411.45 g/mol. Its IUPAC name is N-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]-2-(trifluoromethylsulfanyl)benzamide.
| Compound Name | N-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]-2-(trifluoromethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 60556371 |
| Molecular Formula | C19H20F3N3O2S |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | N-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]-2-(trifluoromethylsulfanyl)benzamide |
| SMILES | CC(C)NC(=O)Nc1ccc(CNC(=O)c2ccccc2SC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H20F3N3O2S/c1-12(2)24-18(27)25-14-9-7-13(8-10-14)11-23-17(26)15-5-3-4-6-16(15)28-19(20,21)22/h3-10,12H,11H2,1-2H3,(H,23,26)(H2,24,25,27) |
| InChIKey | OJXCUCMWAAELKU-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |