C16H12BrF3N2O2S — CID 55880032
N-[2-(4-bromoanilino)-2-oxoethyl]-2-(trifluoromethylsulfanyl)benzamide (PubChem CID 55880032) has the molecular formula C16H12BrF3N2O2S and a molecular weight of 433.25 g/mol. Its IUPAC name is N-[2-(4-bromoanilino)-2-oxoethyl]-2-(trifluoromethylsulfanyl)benzamide.
| Compound Name | N-[2-(4-bromoanilino)-2-oxoethyl]-2-(trifluoromethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 55880032 |
| Molecular Formula | C16H12BrF3N2O2S |
| Molecular Weight | 433.25 g/mol |
| Exact Mass | 431.98 |
| IUPAC Name | N-[2-(4-bromoanilino)-2-oxoethyl]-2-(trifluoromethylsulfanyl)benzamide |
| SMILES | O=C(CNC(=O)c1ccccc1SC(F)(F)F)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C16H12BrF3N2O2S/c17-10-5-7-11(8-6-10)22-14(23)9-21-15(24)12-3-1-2-4-13(12)25-16(18,19)20/h1-8H,9H2,(H,21,24)(H,22,23) |
| InChIKey | YXUKFSMDEDLTLO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.25 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |