C12H14F3NOS — CID 60753360
N,N-diethyl-2-(trifluoromethylsulfanyl)benzamide (PubChem CID 60753360) has the molecular formula C12H14F3NOS and a molecular weight of 277.31 g/mol. Its IUPAC name is N,N-diethyl-2-(trifluoromethylsulfanyl)benzamide.
| Compound Name | N,N-diethyl-2-(trifluoromethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 60753360 |
| Molecular Formula | C12H14F3NOS |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | N,N-diethyl-2-(trifluoromethylsulfanyl)benzamide |
| SMILES | CCN(CC)C(=O)c1ccccc1SC(F)(F)F |
| InChI | InChI=1S/C12H14F3NOS/c1-3-16(4-2)11(17)9-7-5-6-8-10(9)18-12(13,14)15/h5-8H,3-4H2,1-2H3 |
| InChIKey | MXXOUKYVHNEVCK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |