C18H20F3N3OS — CID 55964551
N-[[6-(diethylamino)-3-pyridinyl]methyl]-2-(trifluoromethylsulfanyl)benzamide (PubChem CID 55964551) has the molecular formula C18H20F3N3OS and a molecular weight of 383.44 g/mol. Its IUPAC name is N-[[6-(diethylamino)-3-pyridinyl]methyl]-2-(trifluoromethylsulfanyl)benzamide.
| Compound Name | N-[[6-(diethylamino)-3-pyridinyl]methyl]-2-(trifluoromethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 55964551 |
| Molecular Formula | C18H20F3N3OS |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | N-[[6-(diethylamino)-3-pyridinyl]methyl]-2-(trifluoromethylsulfanyl)benzamide |
| SMILES | CCN(CC)c1ccc(CNC(=O)c2ccccc2SC(F)(F)F)cn1 |
| InChI | InChI=1S/C18H20F3N3OS/c1-3-24(4-2)16-10-9-13(11-22-16)12-23-17(25)14-7-5-6-8-15(14)26-18(19,20)21/h5-11H,3-4,12H2,1-2H3,(H,23,25) |
| InChIKey | POXKJHSNUYIQFX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |