C18H33NOSi2 — CID 163323510
2-[dimethyl(trimethylsilyl)silyl]-N,N-di(propan-2-yl)benzamide (PubChem CID 163323510) has the molecular formula C18H33NOSi2 and a molecular weight of 335.64 g/mol. Its IUPAC name is 2-[dimethyl(trimethylsilyl)silyl]-N,N-di(propan-2-yl)benzamide.
| Compound Name | 2-[dimethyl(trimethylsilyl)silyl]-N,N-di(propan-2-yl)benzamide |
|---|---|
| PubChem CID | 163323510 |
| Molecular Formula | C18H33NOSi2 |
| Molecular Weight | 335.64 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 2-[dimethyl(trimethylsilyl)silyl]-N,N-di(propan-2-yl)benzamide |
| SMILES | CC(C)N(C(=O)c1ccccc1[Si](C)(C)[Si](C)(C)C)C(C)C |
| InChI | InChI=1S/C18H33NOSi2/c1-14(2)19(15(3)4)18(20)16-12-10-11-13-17(16)22(8,9)21(5,6)7/h10-15H,1-9H3 |
| InChIKey | QWKHFWYNZNYPSQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.64 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|