C38H44N2O2Se2 — CID 15268349
2-[2-[[2-[2-[di(propan-2-yl)carbamoyl]phenyl]phenyl]diselanyl]phenyl]-N,N-di(propan-2-yl)benzamide (PubChem CID 15268349) has the molecular formula C38H44N2O2Se2 and a molecular weight of 718.70 g/mol. Its IUPAC name is 2-[2-[[2-[2-[di(propan-2-yl)carbamoyl]phenyl]phenyl]diselanyl]phenyl]-N,N-di(propan-2-yl)benzamide.
| Compound Name | 2-[2-[[2-[2-[di(propan-2-yl)carbamoyl]phenyl]phenyl]diselanyl]phenyl]-N,N-di(propan-2-yl)benzamide |
|---|---|
| PubChem CID | 15268349 |
| Molecular Formula | C38H44N2O2Se2 |
| Molecular Weight | 718.70 g/mol |
| Exact Mass | 720.17 |
| IUPAC Name | 2-[2-[[2-[2-[di(propan-2-yl)carbamoyl]phenyl]phenyl]diselanyl]phenyl]-N,N-di(propan-2-yl)benzamide |
| SMILES | CC(C)N(C(=O)c1ccccc1-c1ccccc1[Se][Se]c1ccccc1-c1ccccc1C(=O)N(C(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C38H44N2O2Se2/c1-25(2)39(26(3)4)37(41)33-21-11-9-17-29(33)31-19-13-15-23-35(31)43-44-36-24-16-14-20-32(36)30-18-10-12-22-34(30)38(42)40(27(5)6)28(7)8/h9-28H,1-8H3 |
| InChIKey | OXLDWSKTGNXLCD-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.70 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|