C17H22N2O4S — CID 177464171
N'-methylsulfonyl-2-oxo-N,N-di(propan-2-yl)chromene-3-carboximidamide (PubChem CID 177464171) has the molecular formula C17H22N2O4S and a molecular weight of 350.44 g/mol. Its IUPAC name is N'-methylsulfonyl-2-oxo-N,N-di(propan-2-yl)chromene-3-carboximidamide.
| Compound Name | N'-methylsulfonyl-2-oxo-N,N-di(propan-2-yl)chromene-3-carboximidamide |
|---|---|
| PubChem CID | 177464171 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | N'-methylsulfonyl-2-oxo-N,N-di(propan-2-yl)chromene-3-carboximidamide |
| SMILES | CC(C)N(/C(=N/S(C)(=O)=O)c1cc2ccccc2oc1=O)C(C)C |
| InChI | InChI=1S/C17H22N2O4S/c1-11(2)19(12(3)4)16(18-24(5,21)22)14-10-13-8-6-7-9-15(13)23-17(14)20/h6-12H,1-5H3/b18-16+ |
| InChIKey | INUOGBDGJZOAMW-FBMGVBCBSA-N |
| XLogP | 2.62 |
| TPSA | 79.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|