C26H36N4O2 — CID 102350895
3-[[3-[di(propan-2-yl)carbamoyl]phenyl]diazenyl]-N,N-di(propan-2-yl)benzamide (PubChem CID 102350895) has the molecular formula C26H36N4O2 and a molecular weight of 436.60 g/mol. Its IUPAC name is 3-[[3-[di(propan-2-yl)carbamoyl]phenyl]diazenyl]-N,N-di(propan-2-yl)benzamide.
| Compound Name | 3-[[3-[di(propan-2-yl)carbamoyl]phenyl]diazenyl]-N,N-di(propan-2-yl)benzamide |
|---|---|
| PubChem CID | 102350895 |
| Molecular Formula | C26H36N4O2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | 3-[[3-[di(propan-2-yl)carbamoyl]phenyl]diazenyl]-N,N-di(propan-2-yl)benzamide |
| SMILES | CC(C)N(C(=O)c1cccc(/N=N/c2cccc(C(=O)N(C(C)C)C(C)C)c2)c1)C(C)C |
| InChI | InChI=1S/C26H36N4O2/c1-17(2)29(18(3)4)25(31)21-11-9-13-23(15-21)27-28-24-14-10-12-22(16-24)26(32)30(19(5)6)20(7)8/h9-20H,1-8H3/b28-27+ |
| InChIKey | MCEAJFHVMOUDPI-BYYHNAKLSA-N |
| XLogP | 6.62 |
| TPSA | 65.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|