C20H37NOSi2 — CID 122210203
4-[bis(trimethylsilyl)methyl]-N,N-di(propan-2-yl)benzamide (PubChem CID 122210203) has the molecular formula C20H37NOSi2 and a molecular weight of 363.69 g/mol. Its IUPAC name is 4-[bis(trimethylsilyl)methyl]-N,N-di(propan-2-yl)benzamide.
| Compound Name | 4-[bis(trimethylsilyl)methyl]-N,N-di(propan-2-yl)benzamide |
|---|---|
| PubChem CID | 122210203 |
| Molecular Formula | C20H37NOSi2 |
| Molecular Weight | 363.69 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | 4-[bis(trimethylsilyl)methyl]-N,N-di(propan-2-yl)benzamide |
| SMILES | CC(C)N(C(=O)c1ccc(C([Si](C)(C)C)[Si](C)(C)C)cc1)C(C)C |
| InChI | InChI=1S/C20H37NOSi2/c1-15(2)21(16(3)4)19(22)17-11-13-18(14-12-17)20(23(5,6)7)24(8,9)10/h11-16,20H,1-10H3 |
| InChIKey | JUQOVDANNXSDEV-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.69 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|