C24H36N2OSi — CID 135076008
4-[di(propan-2-yl)-pyridin-2-ylsilyl]-N,N-di(propan-2-yl)benzamide (PubChem CID 135076008) has the molecular formula C24H36N2OSi and a molecular weight of 396.65 g/mol. Its IUPAC name is 4-[di(propan-2-yl)-pyridin-2-ylsilyl]-N,N-di(propan-2-yl)benzamide.
| Compound Name | 4-[di(propan-2-yl)-pyridin-2-ylsilyl]-N,N-di(propan-2-yl)benzamide |
|---|---|
| PubChem CID | 135076008 |
| Molecular Formula | C24H36N2OSi |
| Molecular Weight | 396.65 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | 4-[di(propan-2-yl)-pyridin-2-ylsilyl]-N,N-di(propan-2-yl)benzamide |
| SMILES | CC(C)N(C(=O)c1ccc([Si](c2ccccn2)(C(C)C)C(C)C)cc1)C(C)C |
| InChI | InChI=1S/C24H36N2OSi/c1-17(2)26(18(3)4)24(27)21-12-14-22(15-13-21)28(19(5)6,20(7)8)23-11-9-10-16-25-23/h9-20H,1-8H3 |
| InChIKey | XXXQLOBUDAYKJW-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.65 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|