About N'-butan-2-yl-3-chloro-N-ethyl-N'-(3-phenyldiazenylbenzoyl)-5-sulfanylbenzohydrazide
N'-butan-2-yl-3-chloro-N-ethyl-N'-(3-phenyldiazenylbenzoyl)-5-sulfanylbenzohydrazide (PubChem CID 19753007) has the molecular formula C26H27ClN4O2S
and a molecular weight of 495.05 g/mol. Its IUPAC name is N'-butan-2-yl-3-chloro-N-ethyl-N'-(3-phenyldiazenylbenzoyl)-5-sulfanylbenzohydrazide.
Molecular Properties
| Compound Name | N'-butan-2-yl-3-chloro-N-ethyl-N'-(3-phenyldiazenylbenzoyl)-5-sulfanylbenzohydrazide |
| PubChem CID | 19753007 |
| Molecular Formula | C26H27ClN4O2S |
| Molecular Weight | 495.05 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | N'-butan-2-yl-3-chloro-N-ethyl-N'-(3-phenyldiazenylbenzoyl)-5-sulfanylbenzohydrazide |
| SMILES | CCC(C)N(C(=O)c1cccc(/N=N/c2ccccc2)c1)N(CC)C(=O)c1cc(S)cc(Cl)c1 |
| InChI | InChI=1S/C26H27ClN4O2S/c1-4-18(3)31(30(5-2)25(32)20-14-21(27)17-24(34)16-20)26(33)19-10-9-13-23(15-19)29-28-22-11-7-6-8-12-22/h6-18,34H,4-5H2,1-3H3/b29-28+ |
| InChIKey | KVIFVIVCKWOPEY-ZQHSETAFSA-N |
| XLogP | 7.36 |
| TPSA | 65.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 495.05 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N'-butan-2-yl-3-chloro-N-ethyl-N'-(3-phenyldiazenylbenzoyl)-5-sulfanylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-butan-2-yl-3-chloro-N-ethyl-N'-(3-phenyldiazenylbenzoyl)-5-sulfanylbenzohydrazide?
The IUPAC name of N'-butan-2-yl-3-chloro-N-ethyl-N'-(3-phenyldiazenylbenzoyl)-5-sulfanylbenzohydrazide (CID 19753007) is N'-butan-2-yl-3-chloro-N-ethyl-N'-(3-phenyldiazenylbenzoyl)-5-sulfanylbenzohydrazide.
What is the SMILES notation for N'-butan-2-yl-3-chloro-N-ethyl-N'-(3-phenyldiazenylbenzoyl)-5-sulfanylbenzohydrazide?
The canonical SMILES for N'-butan-2-yl-3-chloro-N-ethyl-N'-(3-phenyldiazenylbenzoyl)-5-sulfanylbenzohydrazide is CCC(C)N(C(=O)c1cccc(/N=N/c2ccccc2)c1)N(CC)C(=O)c1cc(S)cc(Cl)c1.
What is the InChIKey of N'-butan-2-yl-3-chloro-N-ethyl-N'-(3-phenyldiazenylbenzoyl)-5-sulfanylbenzohydrazide?
The InChIKey is KVIFVIVCKWOPEY-ZQHSETAFSA-N. The full InChI is InChI=1S/C26H27ClN4O2S/c1-4-18(3)31(30(5-2)25(32)20-14-21(27)17-24(34)16-20)26(33)19-10-9-13-23(15-19)29-28-22-11-7-6-8-12-22/h6-18,34H,4-5H2,1-3H3/b29-28+.
What are the key properties of N'-butan-2-yl-3-chloro-N-ethyl-N'-(3-phenyldiazenylbenzoyl)-5-sulfanylbenzohydrazide?
N'-butan-2-yl-3-chloro-N-ethyl-N'-(3-phenyldiazenylbenzoyl)-5-sulfanylbenzohydrazide has a molecular weight of 495.05 g/mol, XLogP of 7.36, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-butan-2-yl-3-chloro-N-ethyl-N'-(3-phenyldiazenylbenzoyl)-5-sulfanylbenzohydrazide is sourced from PubChem (CID 19753007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).