C30H40B2F2N2O6 — CID 158042640
N-(cyclopropylmethyl)-2-fluoro-N-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide;[3-[cyclopropylmethyl(methyl)carbamoyl]-2-fluorophenyl]boronic acid (PubChem CID 158042640) has the molecular formula C30H40B2F2N2O6 and a molecular weight of 584.28 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2-fluoro-N-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide;[3-[cyclopropylmethyl(methyl)carbamoyl]-2-fluorophenyl]boronic acid.
| Compound Name | N-(cyclopropylmethyl)-2-fluoro-N-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide;[3-[cyclopropylmethyl(methyl)carbamoyl]-2-fluorophenyl]boronic acid |
|---|---|
| PubChem CID | 158042640 |
| Molecular Formula | C30H40B2F2N2O6 |
| Molecular Weight | 584.28 g/mol |
| Exact Mass | 584.30 |
| IUPAC Name | N-(cyclopropylmethyl)-2-fluoro-N-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide;[3-[cyclopropylmethyl(methyl)carbamoyl]-2-fluorophenyl]boronic acid |
| SMILES | CN(CC1CC1)C(=O)c1cccc(B(O)O)c1F.CN(CC1CC1)C(=O)c1cccc(B2OC(C)(C)C(C)(C)O2)c1F |
| InChI | InChI=1S/C18H25BFNO3.C12H15BFNO3/c1-17(2)18(3,4)24-19(23-17)14-8-6-7-13(15(14)20)16(22)21(5)11-12-9-10-12;1-15(7-8-5-6-8)12(16)9-3-2-4-10(11(9)14)13(17)18/h6-8,12H,9-11H2,1-5H3;2-4,8,17-18H,5-7H2,1H3 |
| InChIKey | FINNULLOQWATKO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|