C18H31BN2O4S — CID 66701765
2-(diethylamino)-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanesulfonamide (PubChem CID 66701765) has the molecular formula C18H31BN2O4S and a molecular weight of 382.34 g/mol. Its IUPAC name is 2-(diethylamino)-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanesulfonamide.
| Compound Name | 2-(diethylamino)-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 66701765 |
| Molecular Formula | C18H31BN2O4S |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 2-(diethylamino)-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanesulfonamide |
| SMILES | CCN(CC)CCS(=O)(=O)Nc1cccc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C18H31BN2O4S/c1-7-21(8-2)12-13-26(22,23)20-16-11-9-10-15(14-16)19-24-17(3,4)18(5,6)25-19/h9-11,14,20H,7-8,12-13H2,1-6H3 |
| InChIKey | QYMNMFRQQPXTDE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|