C17H27BN2O4S — CID 89096602
2-(diethylamino)-N-[4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)phenyl]ethanesulfonamide (PubChem CID 89096602) has the molecular formula C17H27BN2O4S and a molecular weight of 366.29 g/mol. Its IUPAC name is 2-(diethylamino)-N-[4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)phenyl]ethanesulfonamide.
| Compound Name | 2-(diethylamino)-N-[4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 89096602 |
| Molecular Formula | C17H27BN2O4S |
| Molecular Weight | 366.29 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 2-(diethylamino)-N-[4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)phenyl]ethanesulfonamide |
| SMILES | C=C1OB(c2ccc(NS(=O)(=O)CCN(CC)CC)cc2)OC1(C)C |
| InChI | InChI=1S/C17H27BN2O4S/c1-6-20(7-2)12-13-25(21,22)19-16-10-8-15(9-11-16)18-23-14(3)17(4,5)24-18/h8-11,19H,3,6-7,12-13H2,1-2,4-5H3 |
| InChIKey | HIJXMLXWCIYLNY-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|