C13H14BNO4S — CID 89121591
N-[4-(4,5-dimethylidene-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-ene-1-sulfonamide (PubChem CID 89121591) has the molecular formula C13H14BNO4S and a molecular weight of 291.14 g/mol. Its IUPAC name is N-[4-(4,5-dimethylidene-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-ene-1-sulfonamide.
| Compound Name | N-[4-(4,5-dimethylidene-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-ene-1-sulfonamide |
|---|---|
| PubChem CID | 89121591 |
| Molecular Formula | C13H14BNO4S |
| Molecular Weight | 291.14 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | N-[4-(4,5-dimethylidene-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-ene-1-sulfonamide |
| SMILES | C=CCS(=O)(=O)Nc1ccc(B2OC(=C)C(=C)O2)cc1 |
| InChI | InChI=1S/C13H14BNO4S/c1-4-9-20(16,17)15-13-7-5-12(6-8-13)14-18-10(2)11(3)19-14/h4-8,15H,1-3,9H2 |
| InChIKey | ALLDSRISNUQAQA-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.14 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|