C8H11N3O2S — CID 79673500
N-(6-amino-3-pyridinyl)prop-2-ene-1-sulfonamide (PubChem CID 79673500) has the molecular formula C8H11N3O2S and a molecular weight of 213.26 g/mol. Its IUPAC name is N-(6-amino-3-pyridinyl)prop-2-ene-1-sulfonamide.
| Compound Name | N-(6-amino-3-pyridinyl)prop-2-ene-1-sulfonamide |
|---|---|
| PubChem CID | 79673500 |
| Molecular Formula | C8H11N3O2S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | N-(6-amino-3-pyridinyl)prop-2-ene-1-sulfonamide |
| SMILES | C=CCS(=O)(=O)Nc1ccc(N)nc1 |
| InChI | InChI=1S/C8H11N3O2S/c1-2-5-14(12,13)11-7-3-4-8(9)10-6-7/h2-4,6,11H,1,5H2,(H2,9,10) |
| InChIKey | KSUDTYPQRDWTPS-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|