C6H10ClN3O2S — CID 155970466
N-(6-amino-3-pyridinyl)methanesulfonamide;hydrochloride (PubChem CID 155970466) has the molecular formula C6H10ClN3O2S and a molecular weight of 223.69 g/mol. Its IUPAC name is N-(6-amino-3-pyridinyl)methanesulfonamide;hydrochloride.
| Compound Name | N-(6-amino-3-pyridinyl)methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 155970466 |
| Molecular Formula | C6H10ClN3O2S |
| Molecular Weight | 223.69 g/mol |
| Exact Mass | 223.02 |
| IUPAC Name | N-(6-amino-3-pyridinyl)methanesulfonamide;hydrochloride |
| SMILES | CS(=O)(=O)Nc1ccc(N)nc1.Cl |
| InChI | InChI=1S/C6H9N3O2S.ClH/c1-12(10,11)9-5-2-3-6(7)8-4-5;/h2-4,9H,1H3,(H2,7,8);1H |
| InChIKey | OMZHXCZJRBHAHT-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.69 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |