C10H16N4O3S — CID 119516146
N-(6-amino-3-pyridinyl)-2-(methanesulfonamido)-2-methylpropanamide (PubChem CID 119516146) has the molecular formula C10H16N4O3S and a molecular weight of 272.33 g/mol. Its IUPAC name is N-(6-amino-3-pyridinyl)-2-(methanesulfonamido)-2-methylpropanamide.
| Compound Name | N-(6-amino-3-pyridinyl)-2-(methanesulfonamido)-2-methylpropanamide |
|---|---|
| PubChem CID | 119516146 |
| Molecular Formula | C10H16N4O3S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | N-(6-amino-3-pyridinyl)-2-(methanesulfonamido)-2-methylpropanamide |
| SMILES | CC(C)(NS(C)(=O)=O)C(=O)Nc1ccc(N)nc1 |
| InChI | InChI=1S/C10H16N4O3S/c1-10(2,14-18(3,16)17)9(15)13-7-4-5-8(11)12-6-7/h4-6,14H,1-3H3,(H2,11,12)(H,13,15) |
| InChIKey | UWTDGRVOJOVKIO-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |