C17H22ClN3O — CID 119515768
N-(6-amino-3-pyridinyl)-2-(4-ethylphenyl)-2-methylpropanamide;hydrochloride (PubChem CID 119515768) has the molecular formula C17H22ClN3O and a molecular weight of 319.84 g/mol. Its IUPAC name is N-(6-amino-3-pyridinyl)-2-(4-ethylphenyl)-2-methylpropanamide;hydrochloride.
| Compound Name | N-(6-amino-3-pyridinyl)-2-(4-ethylphenyl)-2-methylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119515768 |
| Molecular Formula | C17H22ClN3O |
| Molecular Weight | 319.84 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | N-(6-amino-3-pyridinyl)-2-(4-ethylphenyl)-2-methylpropanamide;hydrochloride |
| SMILES | CCc1ccc(C(C)(C)C(=O)Nc2ccc(N)nc2)cc1.Cl |
| InChI | InChI=1S/C17H21N3O.ClH/c1-4-12-5-7-13(8-6-12)17(2,3)16(21)20-14-9-10-15(18)19-11-14;/h5-11H,4H2,1-3H3,(H2,18,19)(H,20,21);1H |
| InChIKey | UGIGAVPIHZWRQW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.84 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |