C13H20ClN3O — CID 119515973
N-(6-amino-3-pyridinyl)-1-ethylcyclopentane-1-carboxamide;hydrochloride (PubChem CID 119515973) has the molecular formula C13H20ClN3O and a molecular weight of 269.78 g/mol. Its IUPAC name is N-(6-amino-3-pyridinyl)-1-ethylcyclopentane-1-carboxamide;hydrochloride.
| Compound Name | N-(6-amino-3-pyridinyl)-1-ethylcyclopentane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119515973 |
| Molecular Formula | C13H20ClN3O |
| Molecular Weight | 269.78 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | N-(6-amino-3-pyridinyl)-1-ethylcyclopentane-1-carboxamide;hydrochloride |
| SMILES | CCC1(C(=O)Nc2ccc(N)nc2)CCCC1.Cl |
| InChI | InChI=1S/C13H19N3O.ClH/c1-2-13(7-3-4-8-13)12(17)16-10-5-6-11(14)15-9-10;/h5-6,9H,2-4,7-8H2,1H3,(H2,14,15)(H,16,17);1H |
| InChIKey | DAQBPWFZEKKVDH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.78 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |