C17H19ClFN3O — CID 119516222
N-(6-amino-3-pyridinyl)-1-(4-fluorophenyl)cyclopentane-1-carboxamide;hydrochloride (PubChem CID 119516222) has the molecular formula C17H19ClFN3O and a molecular weight of 335.81 g/mol. Its IUPAC name is N-(6-amino-3-pyridinyl)-1-(4-fluorophenyl)cyclopentane-1-carboxamide;hydrochloride.
| Compound Name | N-(6-amino-3-pyridinyl)-1-(4-fluorophenyl)cyclopentane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119516222 |
| Molecular Formula | C17H19ClFN3O |
| Molecular Weight | 335.81 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | N-(6-amino-3-pyridinyl)-1-(4-fluorophenyl)cyclopentane-1-carboxamide;hydrochloride |
| SMILES | Cl.Nc1ccc(NC(=O)C2(c3ccc(F)cc3)CCCC2)cn1 |
| InChI | InChI=1S/C17H18FN3O.ClH/c18-13-5-3-12(4-6-13)17(9-1-2-10-17)16(22)21-14-7-8-15(19)20-11-14;/h3-8,11H,1-2,9-10H2,(H2,19,20)(H,21,22);1H |
| InChIKey | HDACQVQJPRWHAD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.81 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |