C22H23FN2O4 — CID 119224606
2-[[2-[4-[[1-(4-fluorophenyl)cyclopentanecarbonyl]amino]phenyl]acetyl]amino]acetic acid (PubChem CID 119224606) has the molecular formula C22H23FN2O4 and a molecular weight of 398.43 g/mol. Its IUPAC name is 2-[[2-[4-[[1-(4-fluorophenyl)cyclopentanecarbonyl]amino]phenyl]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[4-[[1-(4-fluorophenyl)cyclopentanecarbonyl]amino]phenyl]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 119224606 |
| Molecular Formula | C22H23FN2O4 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 2-[[2-[4-[[1-(4-fluorophenyl)cyclopentanecarbonyl]amino]phenyl]acetyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)Cc1ccc(NC(=O)C2(c3ccc(F)cc3)CCCC2)cc1 |
| InChI | InChI=1S/C22H23FN2O4/c23-17-7-5-16(6-8-17)22(11-1-2-12-22)21(29)25-18-9-3-15(4-10-18)13-19(26)24-14-20(27)28/h3-10H,1-2,11-14H2,(H,24,26)(H,25,29)(H,27,28) |
| InChIKey | HBQBEZPMDBPCSU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |