C16H15Cl2N3O — CID 119515328
N-(6-amino-3-pyridinyl)-1-(3,4-dichlorophenyl)cyclobutane-1-carboxamide (PubChem CID 119515328) has the molecular formula C16H15Cl2N3O and a molecular weight of 336.22 g/mol. Its IUPAC name is N-(6-amino-3-pyridinyl)-1-(3,4-dichlorophenyl)cyclobutane-1-carboxamide.
| Compound Name | N-(6-amino-3-pyridinyl)-1-(3,4-dichlorophenyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 119515328 |
| Molecular Formula | C16H15Cl2N3O |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | N-(6-amino-3-pyridinyl)-1-(3,4-dichlorophenyl)cyclobutane-1-carboxamide |
| SMILES | Nc1ccc(NC(=O)C2(c3ccc(Cl)c(Cl)c3)CCC2)cn1 |
| InChI | InChI=1S/C16H15Cl2N3O/c17-12-4-2-10(8-13(12)18)16(6-1-7-16)15(22)21-11-3-5-14(19)20-9-11/h2-5,8-9H,1,6-7H2,(H2,19,20)(H,21,22) |
| InChIKey | AYQTYYVIEBITGS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |