C15H13Cl2N3O — CID 122146724
1-(3,4-dichlorophenyl)-N-pyrimidin-2-ylcyclobutane-1-carboxamide (PubChem CID 122146724) has the molecular formula C15H13Cl2N3O and a molecular weight of 322.19 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-N-pyrimidin-2-ylcyclobutane-1-carboxamide.
| Compound Name | 1-(3,4-dichlorophenyl)-N-pyrimidin-2-ylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 122146724 |
| Molecular Formula | C15H13Cl2N3O |
| Molecular Weight | 322.19 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-N-pyrimidin-2-ylcyclobutane-1-carboxamide |
| SMILES | O=C(Nc1ncccn1)C1(c2ccc(Cl)c(Cl)c2)CCC1 |
| InChI | InChI=1S/C15H13Cl2N3O/c16-11-4-3-10(9-12(11)17)15(5-1-6-15)13(21)20-14-18-7-2-8-19-14/h2-4,7-9H,1,5-6H2,(H,18,19,20,21) |
| InChIKey | PSRVJYWFUZSMDM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.19 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |